C23H31N3O4 — CID 54825060
3-[[2-(3-butoxyanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54825060) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[[2-(3-butoxyanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[[2-(3-butoxyanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54825060 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 3-[[2-(3-butoxyanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCOc1cccc(NCC(=O)Nc2cccc(C(=O)NCCCOC)c2)c1 |
| InChI | InChI=1S/C23H31N3O4/c1-3-4-14-30-21-11-6-9-19(16-21)25-17-22(27)26-20-10-5-8-18(15-20)23(28)24-12-7-13-29-2/h5-6,8-11,15-16,25H,3-4,7,12-14,17H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | VFJKHDXKXHOVLU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|