C27H31N3O4 — CID 54834119
N-butyl-3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide (PubChem CID 54834119) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-butyl-3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | N-butyl-3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834119 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-butyl-3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1cccc(NCC(=O)Nc2cccc(OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H31N3O4/c1-2-3-15-28-27(32)21-9-7-10-22(18-21)29-20-26(31)30-23-11-8-14-25(19-23)34-17-16-33-24-12-5-4-6-13-24/h4-14,18-19,29H,2-3,15-17,20H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | KVWGFGGIFRREPW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|