C22H29N3O5 — CID 54827524
3-[[2-[3-(2-ethoxyethoxy)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 54827524) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[[2-[3-(2-ethoxyethoxy)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[2-[3-(2-ethoxyethoxy)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 54827524 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[[2-[3-(2-ethoxyethoxy)anilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | CCOCCOc1cccc(NCC(=O)Nc2cccc(C(=O)NCCOC)c2)c1 |
| InChI | InChI=1S/C22H29N3O5/c1-3-29-12-13-30-20-9-5-7-18(15-20)24-16-21(26)25-19-8-4-6-17(14-19)22(27)23-10-11-28-2/h4-9,14-15,24H,3,10-13,16H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | MODQMIQHBONXCM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|