C23H31N3O5 — CID 54842538
3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54842538) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54842538 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | CCOCCOc1ccc(NC(=O)CNc2cccc(C(=O)NCCCOC)c2)cc1 |
| InChI | InChI=1S/C23H31N3O5/c1-3-30-14-15-31-21-10-8-19(9-11-21)26-22(27)17-25-20-7-4-6-18(16-20)23(28)24-12-5-13-29-2/h4,6-11,16,25H,3,5,12-15,17H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | BJRUOWAFQRRJEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|