C20H25N3O4 — CID 54840849
3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]-N,N-dimethylbenzamide (PubChem CID 54840849) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54840849 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]-N,N-dimethylbenzamide |
| SMILES | COCCOc1ccc(NC(=O)CNc2cccc(C(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-23(2)20(25)15-5-4-6-17(13-15)21-14-19(24)22-16-7-9-18(10-8-16)27-12-11-26-3/h4-10,13,21H,11-12,14H2,1-3H3,(H,22,24) |
| InChIKey | IGJSNCNNGHUNJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|