C24H32N4O4 — CID 54844318
N-tert-butyl-3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54844318) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-tert-butyl-3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-tert-butyl-3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54844318 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-tert-butyl-3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CNc2cccc(C(=O)NC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H32N4O4/c1-24(2,3)28-23(31)18-7-5-8-20(15-18)26-16-21(29)27-19-11-9-17(10-12-19)22(30)25-13-6-14-32-4/h5,7-12,15,26H,6,13-14,16H2,1-4H3,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | GPERHRPKIMNOIP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|