C20H22F3N3O3 — CID 54833624
N-(3-methoxypropyl)-4-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide (PubChem CID 54833624) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-(3-methoxypropyl)-4-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54833624 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(3-methoxypropyl)-4-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-29-11-3-10-24-19(28)14-6-8-16(9-7-14)26-18(27)13-25-17-5-2-4-15(12-17)20(21,22)23/h2,4-9,12,25H,3,10-11,13H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | SRYCLYDZXROWRO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|