C27H30N4O4 — CID 54837360
3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54837360) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54837360 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 3-[[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CNc2cccc(C(=O)N(C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-31(24-10-4-3-5-11-24)27(34)21-8-6-9-23(18-21)29-19-25(32)30-22-14-12-20(13-15-22)26(33)28-16-7-17-35-2/h3-6,8-15,18,29H,7,16-17,19H2,1-2H3,(H,28,33)(H,30,32) |
| InChIKey | HROXAQWKCHCIRJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|