C22H28N4O4 — CID 54836454
4-[[2-[4-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54836454) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[[2-[4-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[2-[4-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54836454 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-[[2-[4-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)CNc2ccc(C(=O)NCCCOC)cc2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-3-23-21(28)16-7-11-19(12-8-16)26-20(27)15-25-18-9-5-17(6-10-18)22(29)24-13-4-14-30-2/h5-12,25H,3-4,13-15H2,1-2H3,(H,23,28)(H,24,29)(H,26,27) |
| InChIKey | HWOFZWYMXTZJCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|