C24H26N4O5 — CID 54843328
N-[3-[[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843328) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[3-[[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843328 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[3-[[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1cccc(NC(=O)CNc2cccc(NC(=O)c3ccco3)c2)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-32-12-5-11-25-23(30)17-6-2-8-19(14-17)27-22(29)16-26-18-7-3-9-20(15-18)28-24(31)21-10-4-13-33-21/h2-4,6-10,13-15,26H,5,11-12,16H2,1H3,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | IWEDTNGARXXVPB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|