C22H23N3O5 — CID 54843353
N-[3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843353) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843353 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)CNc2cccc(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-28-12-13-29-19-9-7-16(8-10-19)24-21(26)15-23-17-4-2-5-18(14-17)25-22(27)20-6-3-11-30-20/h2-11,14,23H,12-13,15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | HIUYZSQLMLGSEI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|