C26H23N3O4 — CID 54822034
N-[3-[[2-(4-phenylmethoxyanilino)acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54822034) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[3-[[2-(4-phenylmethoxyanilino)acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(4-phenylmethoxyanilino)acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54822034 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[3-[[2-(4-phenylmethoxyanilino)acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CNc1ccc(OCc2ccccc2)cc1)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C26H23N3O4/c30-25(28-21-8-4-9-22(16-21)29-26(31)24-10-5-15-32-24)17-27-20-11-13-23(14-12-20)33-18-19-6-2-1-3-7-19/h1-16,27H,17-18H2,(H,28,30)(H,29,31) |
| InChIKey | OPNQXJTYJMBOSH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|