C19H16IN3O3 — CID 54843288
N-[3-[[2-(4-iodoanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843288) has the molecular formula C19H16IN3O3 and a molecular weight of 461.26 g/mol. Its IUPAC name is N-[3-[[2-(4-iodoanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(4-iodoanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843288 |
| Molecular Formula | C19H16IN3O3 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N-[3-[[2-(4-iodoanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CNc1cccc(NC(=O)c2ccco2)c1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C19H16IN3O3/c20-13-6-8-14(9-7-13)22-18(24)12-21-15-3-1-4-16(11-15)23-19(25)17-5-2-10-26-17/h1-11,21H,12H2,(H,22,24)(H,23,25) |
| InChIKey | WRQCRARZKLXJMX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|