C23H23N3O4 — CID 54824284
N-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54824284) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54824284 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | C=C(C)COc1ccc(NCC(=O)Nc2cccc(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-16(2)15-30-20-10-8-17(9-11-20)24-14-22(27)25-18-5-3-6-19(13-18)26-23(28)21-7-4-12-29-21/h3-13,24H,1,14-15H2,2H3,(H,25,27)(H,26,28) |
| InChIKey | XQOPSEBUQOCGPI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|