C23H29N3O3 — CID 54824486
N,N-dimethyl-3-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]propanamide (PubChem CID 54824486) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]propanamide.
| Compound Name | N,N-dimethyl-3-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54824486 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N,N-dimethyl-3-[3-[[2-[4-(2-methylprop-2-enoxy)anilino]acetyl]amino]phenyl]propanamide |
| SMILES | C=C(C)COc1ccc(NCC(=O)Nc2cccc(CCC(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-17(2)16-29-21-11-9-19(10-12-21)24-15-22(27)25-20-7-5-6-18(14-20)8-13-23(28)26(3)4/h5-7,9-12,14,24H,1,8,13,15-16H2,2-4H3,(H,25,27) |
| InChIKey | RXCUEQVVRDAJCO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|