C23H24N4O4 — CID 54843268
N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843268) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843268 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CNc2cccc(NC(=O)c3ccco3)c2)c1C |
| InChI | InChI=1S/C23H24N4O4/c1-3-21(28)26-18-9-5-10-19(15(18)2)27-22(29)14-24-16-7-4-8-17(13-16)25-23(30)20-11-6-12-31-20/h4-13,24H,3,14H2,1-2H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | PPELUGJPDIZEST-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |