C22H28N4O3 — CID 54830788
N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]butanamide (PubChem CID 54830788) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]butanamide.
| Compound Name | N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54830788 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[3-[[2-[2-methyl-3-(propanoylamino)anilino]-2-oxoethyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(NCC(=O)Nc2cccc(NC(=O)CC)c2C)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-8-21(28)24-17-10-6-9-16(13-17)23-14-22(29)26-19-12-7-11-18(15(19)3)25-20(27)5-2/h6-7,9-13,23H,4-5,8,14H2,1-3H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | FFMNUXUXYBQSBQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |