C18H20IN3O2 — CID 54812294
N-[3-[[2-(4-iodoanilino)acetyl]amino]phenyl]butanamide (PubChem CID 54812294) has the molecular formula C18H20IN3O2 and a molecular weight of 437.28 g/mol. Its IUPAC name is N-[3-[[2-(4-iodoanilino)acetyl]amino]phenyl]butanamide.
| Compound Name | N-[3-[[2-(4-iodoanilino)acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54812294 |
| Molecular Formula | C18H20IN3O2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[3-[[2-(4-iodoanilino)acetyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)CNc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C18H20IN3O2/c1-2-4-17(23)21-15-5-3-6-16(11-15)22-18(24)12-20-14-9-7-13(19)8-10-14/h3,5-11,20H,2,4,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | YHPNPJDGBZCWCM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|