C20H24N4O3 — CID 54837270
3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N-methylbenzamide (PubChem CID 54837270) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54837270 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N-methylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(NCC(=O)Nc2cccc(C(=O)NC)c2)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-5-18(25)23-16-10-8-15(9-11-16)22-13-19(26)24-17-7-4-6-14(12-17)20(27)21-2/h4,6-12,22H,3,5,13H2,1-2H3,(H,21,27)(H,23,25)(H,24,26) |
| InChIKey | KDLUMJZMDYJOEJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |