C19H22N4O3 — CID 54837724
N-ethyl-3-[[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54837724) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-ethyl-3-[[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54837724 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-ethyl-3-[[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NCC(=O)Nc2ccc(C(=O)NC)cc2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-21-19(26)14-5-4-6-16(11-14)22-12-17(24)23-15-9-7-13(8-10-15)18(25)20-2/h4-11,22H,3,12H2,1-2H3,(H,20,25)(H,21,26)(H,23,24) |
| InChIKey | VDBSHDDMSFYRGZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |