C21H26N4O3 — CID 54831796
N-ethyl-4-[[2-[3-(2-methylpropanoylamino)anilino]acetyl]amino]benzamide (PubChem CID 54831796) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-ethyl-4-[[2-[3-(2-methylpropanoylamino)anilino]acetyl]amino]benzamide.
| Compound Name | N-ethyl-4-[[2-[3-(2-methylpropanoylamino)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54831796 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-ethyl-4-[[2-[3-(2-methylpropanoylamino)anilino]acetyl]amino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)CNc2cccc(NC(=O)C(C)C)c2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-4-22-21(28)15-8-10-16(11-9-15)24-19(26)13-23-17-6-5-7-18(12-17)25-20(27)14(2)3/h5-12,14,23H,4,13H2,1-3H3,(H,22,28)(H,24,26)(H,25,27) |
| InChIKey | MNSUNRZFESDXCR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |