C19H20FN3O3 — CID 55635839
4-fluoro-N-[2-[3-(2-methylpropanoylamino)anilino]-2-oxoethyl]benzamide (PubChem CID 55635839) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 4-fluoro-N-[2-[3-(2-methylpropanoylamino)anilino]-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[3-(2-methylpropanoylamino)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55635839 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-fluoro-N-[2-[3-(2-methylpropanoylamino)anilino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=O)CNC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H20FN3O3/c1-12(2)18(25)23-16-5-3-4-15(10-16)22-17(24)11-21-19(26)13-6-8-14(20)9-7-13/h3-10,12H,11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | HDEQQDNTRZPNTO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |