C20H17FN4O2 — CID 38310248
4-fluoro-N-[2-[3-(2-methylpyrimidin-4-yl)anilino]-2-oxoethyl]benzamide (PubChem CID 38310248) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-fluoro-N-[2-[3-(2-methylpyrimidin-4-yl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[3-(2-methylpyrimidin-4-yl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 38310248 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-fluoro-N-[2-[3-(2-methylpyrimidin-4-yl)anilino]-2-oxoethyl]benzamide |
| SMILES | Cc1nccc(-c2cccc(NC(=O)CNC(=O)c3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C20H17FN4O2/c1-13-22-10-9-18(24-13)15-3-2-4-17(11-15)25-19(26)12-23-20(27)14-5-7-16(21)8-6-14/h2-11H,12H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | FDJONBZUAMFJLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |