C22H20FN3O — CID 51113892
1-(3-fluorophenyl)-N-[3-(2-methylpyrimidin-4-yl)phenyl]cyclobutane-1-carboxamide (PubChem CID 51113892) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[3-(2-methylpyrimidin-4-yl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[3-(2-methylpyrimidin-4-yl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 51113892 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[3-(2-methylpyrimidin-4-yl)phenyl]cyclobutane-1-carboxamide |
| SMILES | Cc1nccc(-c2cccc(NC(=O)C3(c4cccc(F)c4)CCC3)c2)n1 |
| InChI | InChI=1S/C22H20FN3O/c1-15-24-12-9-20(25-15)16-5-2-8-19(13-16)26-21(27)22(10-4-11-22)17-6-3-7-18(23)14-17/h2-3,5-9,12-14H,4,10-11H2,1H3,(H,26,27) |
| InChIKey | BWQIXNWHCLFMKV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |