C20H22FNO3 — CID 26364802
N-(3,4-dimethoxyphenyl)-1-(3-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 26364802) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-(3-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 26364802 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3cccc(F)c3)CCCC2)cc1OC |
| InChI | InChI=1S/C20H22FNO3/c1-24-17-9-8-16(13-18(17)25-2)22-19(23)20(10-3-4-11-20)14-6-5-7-15(21)12-14/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,22,23) |
| InChIKey | ACIMHENZOUUCEZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |