C20H21ClFNO2 — CID 100674752
N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 100674752) has the molecular formula C20H21ClFNO2 and a molecular weight of 361.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100674752 |
| Molecular Formula | C20H21ClFNO2 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1-(4-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccc(F)cc3)CCCCC2)cc1Cl |
| InChI | InChI=1S/C20H21ClFNO2/c1-25-18-10-9-16(13-17(18)21)23-19(24)20(11-3-2-4-12-20)14-5-7-15(22)8-6-14/h5-10,13H,2-4,11-12H2,1H3,(H,23,24) |
| InChIKey | NIDBUYPAFBIPSS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |