C23H28FNO2 — CID 100664966
N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 100664966) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100664966 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C2(c3ccc(F)cc3)CCCC2)cc1C |
| InChI | InChI=1S/C23H28FNO2/c1-4-17(3)27-21-12-11-20(15-16(21)2)25-22(26)23(13-5-6-14-23)18-7-9-19(24)10-8-18/h7-12,15,17H,4-6,13-14H2,1-3H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | WMTQNAZXKXPLJJ-QGZVFWFLSA-N |
| XLogP | 5.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |