C24H28FNO5 — CID 100749064
methyl 2-[(2S)-butan-2-yl]oxy-5-[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]benzoate (PubChem CID 100749064) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is methyl 2-[(2S)-butan-2-yl]oxy-5-[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[(2S)-butan-2-yl]oxy-5-[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100749064 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | methyl 2-[(2S)-butan-2-yl]oxy-5-[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]benzoate |
| SMILES | CC[C@H](C)Oc1ccc(NC(=O)C2(c3ccc(F)cc3)CCOCC2)cc1C(=O)OC |
| InChI | InChI=1S/C24H28FNO5/c1-4-16(2)31-21-10-9-19(15-20(21)22(27)29-3)26-23(28)24(11-13-30-14-12-24)17-5-7-18(25)8-6-17/h5-10,15-16H,4,11-14H2,1-3H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | JVZUQOSBNOWLSK-INIZCTEOSA-N |
| XLogP | 4.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |