C25H31NO5 — CID 100748343
methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(3-methylphenyl)oxane-4-carbonyl]amino]benzoate (PubChem CID 100748343) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(3-methylphenyl)oxane-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(3-methylphenyl)oxane-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100748343 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(3-methylphenyl)oxane-4-carbonyl]amino]benzoate |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C2(c3cccc(C)c3)CCOCC2)cc1C(=O)OC |
| InChI | InChI=1S/C25H31NO5/c1-5-18(3)31-22-10-9-20(16-21(22)23(27)29-4)26-24(28)25(11-13-30-14-12-25)19-8-6-7-17(2)15-19/h6-10,15-16,18H,5,11-14H2,1-4H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | FHZDFHIPKMTXLN-GOSISDBHSA-N |
| XLogP | 4.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |