C25H31NO5 — CID 133229622
ethyl 2-butan-2-yloxy-5-[(4-phenyloxane-4-carbonyl)amino]benzoate (PubChem CID 133229622) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 2-butan-2-yloxy-5-[(4-phenyloxane-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-butan-2-yloxy-5-[(4-phenyloxane-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 133229622 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | ethyl 2-butan-2-yloxy-5-[(4-phenyloxane-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2(c3ccccc3)CCOCC2)ccc1OC(C)CC |
| InChI | InChI=1S/C25H31NO5/c1-4-18(3)31-22-12-11-20(17-21(22)23(27)30-5-2)26-24(28)25(13-15-29-16-14-25)19-9-7-6-8-10-19/h6-12,17-18H,4-5,13-16H2,1-3H3,(H,26,28) |
| InChIKey | XEMLJIKIPINVPY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |