C26H32ClNO4 — CID 100746593
ethyl 2-[(2S)-butan-2-yl]oxy-5-[[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 100746593) has the molecular formula C26H32ClNO4 and a molecular weight of 458.00 g/mol. Its IUPAC name is ethyl 2-[(2S)-butan-2-yl]oxy-5-[[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | ethyl 2-[(2S)-butan-2-yl]oxy-5-[[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100746593 |
| Molecular Formula | C26H32ClNO4 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 2-[(2S)-butan-2-yl]oxy-5-[[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2(c3ccc(Cl)cc3)CCCCC2)ccc1O[C@@H](C)CC |
| InChI | InChI=1S/C26H32ClNO4/c1-4-18(3)32-23-14-13-21(17-22(23)24(29)31-5-2)28-25(30)26(15-7-6-8-16-26)19-9-11-20(27)12-10-19/h9-14,17-18H,4-8,15-16H2,1-3H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | ZLVFVMQVOHBAIS-SFHVURJKSA-N |
| XLogP | 6.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |