C26H33NO5 — CID 100747453
methyl 2-[(2R)-butan-2-yl]oxy-5-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 100747453) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is methyl 2-[(2R)-butan-2-yl]oxy-5-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100747453 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C2(c3ccc(OC)cc3)CCCCC2)cc1C(=O)OC |
| InChI | InChI=1S/C26H33NO5/c1-5-18(2)32-23-14-11-20(17-22(23)24(28)31-4)27-25(29)26(15-7-6-8-16-26)19-9-12-21(30-3)13-10-19/h9-14,17-18H,5-8,15-16H2,1-4H3,(H,27,29)/t18-/m1/s1 |
| InChIKey | WZLNWOZXTHUUMJ-GOSISDBHSA-N |
| XLogP | 5.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |