C25H31NO6 — CID 100750107
methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(4-methoxyphenyl)oxane-4-carbonyl]amino]benzoate (PubChem CID 100750107) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(4-methoxyphenyl)oxane-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(4-methoxyphenyl)oxane-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100750107 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | methyl 2-[(2R)-butan-2-yl]oxy-5-[[4-(4-methoxyphenyl)oxane-4-carbonyl]amino]benzoate |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C2(c3ccc(OC)cc3)CCOCC2)cc1C(=O)OC |
| InChI | InChI=1S/C25H31NO6/c1-5-17(2)32-22-11-8-19(16-21(22)23(27)30-4)26-24(28)25(12-14-31-15-13-25)18-6-9-20(29-3)10-7-18/h6-11,16-17H,5,12-15H2,1-4H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | RRYOFEVSBKBODH-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |