C23H27NO4 — CID 100745550
methyl 2-methoxy-5-[[1-(4-methylphenyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 100745550) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[1-(4-methylphenyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 2-methoxy-5-[[1-(4-methylphenyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100745550 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl 2-methoxy-5-[[1-(4-methylphenyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2(c3ccc(C)cc3)CCCCC2)ccc1OC |
| InChI | InChI=1S/C23H27NO4/c1-16-7-9-17(10-8-16)23(13-5-4-6-14-23)22(26)24-18-11-12-20(27-2)19(15-18)21(25)28-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,24,26) |
| InChIKey | ZRHSDCVFFKHISH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |