C26H33NO2 — CID 100672600
N-(4-cyclopentyloxy-3-methylphenyl)-1-(4-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 100672600) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-(4-cyclopentyloxy-3-methylphenyl)-1-(4-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-cyclopentyloxy-3-methylphenyl)-1-(4-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100672600 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | N-(4-cyclopentyloxy-3-methylphenyl)-1-(4-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)Nc3ccc(OC4CCCC4)c(C)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C26H33NO2/c1-19-10-12-21(13-11-19)26(16-6-3-7-17-26)25(28)27-22-14-15-24(20(2)18-22)29-23-8-4-5-9-23/h10-15,18,23H,3-9,16-17H2,1-2H3,(H,27,28) |
| InChIKey | VRJXZRFLFQVXMZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |