C25H33NO2 — CID 100672586
N-[3-methyl-4-(2-methylpropoxy)phenyl]-1-(4-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 100672586) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is N-[3-methyl-4-(2-methylpropoxy)phenyl]-1-(4-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[3-methyl-4-(2-methylpropoxy)phenyl]-1-(4-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100672586 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | N-[3-methyl-4-(2-methylpropoxy)phenyl]-1-(4-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)Nc3ccc(OCC(C)C)c(C)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C25H33NO2/c1-18(2)17-28-23-13-12-22(16-20(23)4)26-24(27)25(14-6-5-7-15-25)21-10-8-19(3)9-11-21/h8-13,16,18H,5-7,14-15,17H2,1-4H3,(H,26,27) |
| InChIKey | AKYQOGLACRZUHA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |