C27H32N2O2 — CID 100770996
1-(4-methylphenyl)-N-[8-(2-methylpropoxy)quinolin-5-yl]cyclohexane-1-carboxamide (PubChem CID 100770996) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[8-(2-methylpropoxy)quinolin-5-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[8-(2-methylpropoxy)quinolin-5-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100770996 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-(4-methylphenyl)-N-[8-(2-methylpropoxy)quinolin-5-yl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)Nc3ccc(OCC(C)C)c4ncccc34)CCCCC2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-19(2)18-31-24-14-13-23(22-8-7-17-28-25(22)24)29-26(30)27(15-5-4-6-16-27)21-11-9-20(3)10-12-21/h7-14,17,19H,4-6,15-16,18H2,1-3H3,(H,29,30) |
| InChIKey | QWPDKSKIRQRRMD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |