C25H28N2O3 — CID 100770449
1-(4-methoxyphenyl)-N-(8-propan-2-yloxyquinolin-5-yl)cyclopentane-1-carboxamide (PubChem CID 100770449) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(8-propan-2-yloxyquinolin-5-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-(8-propan-2-yloxyquinolin-5-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100770449 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(8-propan-2-yloxyquinolin-5-yl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)Nc3ccc(OC(C)C)c4ncccc34)CCCC2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-17(2)30-22-13-12-21(20-7-6-16-26-23(20)22)27-24(28)25(14-4-5-15-25)18-8-10-19(29-3)11-9-18/h6-13,16-17H,4-5,14-15H2,1-3H3,(H,27,28) |
| InChIKey | XRDWYRNGKXRCDY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |