C23H24N2O2 — CID 100770558
N-(8-methoxyquinolin-5-yl)-1-phenylcyclohexane-1-carboxamide (PubChem CID 100770558) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(8-methoxyquinolin-5-yl)-1-phenylcyclohexane-1-carboxamide.
| Compound Name | N-(8-methoxyquinolin-5-yl)-1-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100770558 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(8-methoxyquinolin-5-yl)-1-phenylcyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccccc3)CCCCC2)c2cccnc12 |
| InChI | InChI=1S/C23H24N2O2/c1-27-20-13-12-19(18-11-8-16-24-21(18)20)25-22(26)23(14-6-3-7-15-23)17-9-4-2-5-10-17/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3,(H,25,26) |
| InChIKey | SVXSXZKHOVTQKC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |