C21H19NO2 — CID 100782309
N-(4-methoxynaphthalen-1-yl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 100782309) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(4-methoxynaphthalen-1-yl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(4-methoxynaphthalen-1-yl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 100782309 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(4-methoxynaphthalen-1-yl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccccc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C21H19NO2/c1-24-19-12-11-18(16-9-5-6-10-17(16)19)22-20(23)21(13-14-21)15-7-3-2-4-8-15/h2-12H,13-14H2,1H3,(H,22,23) |
| InChIKey | PMFVJKQTHZHEBL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |