C25H31NO4 — CID 100719723
methyl 5-[[1-(3-methylphenyl)cyclopentanecarbonyl]amino]-2-(2-methylpropoxy)benzoate (PubChem CID 100719723) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 5-[[1-(3-methylphenyl)cyclopentanecarbonyl]amino]-2-(2-methylpropoxy)benzoate.
| Compound Name | methyl 5-[[1-(3-methylphenyl)cyclopentanecarbonyl]amino]-2-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 100719723 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | methyl 5-[[1-(3-methylphenyl)cyclopentanecarbonyl]amino]-2-(2-methylpropoxy)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2(c3cccc(C)c3)CCCC2)ccc1OCC(C)C |
| InChI | InChI=1S/C25H31NO4/c1-17(2)16-30-22-11-10-20(15-21(22)23(27)29-4)26-24(28)25(12-5-6-13-25)19-9-7-8-18(3)14-19/h7-11,14-15,17H,5-6,12-13,16H2,1-4H3,(H,26,28) |
| InChIKey | STYSYVCZOQJWEM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |