C24H28ClNO2 — CID 100666997
1-(2-chlorophenyl)-N-(4-cyclopentyloxy-3-methylphenyl)cyclopentane-1-carboxamide (PubChem CID 100666997) has the molecular formula C24H28ClNO2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(4-cyclopentyloxy-3-methylphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(4-cyclopentyloxy-3-methylphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100666997 |
| Molecular Formula | C24H28ClNO2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(4-cyclopentyloxy-3-methylphenyl)cyclopentane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(c3ccccc3Cl)CCCC2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C24H28ClNO2/c1-17-16-18(12-13-22(17)28-19-8-2-3-9-19)26-23(27)24(14-6-7-15-24)20-10-4-5-11-21(20)25/h4-5,10-13,16,19H,2-3,6-9,14-15H2,1H3,(H,26,27) |
| InChIKey | IEZFBAYJDNIBSN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |