C17H15Cl2NO — CID 110439353
N-(3-chloro-4-methylphenyl)-1-(2-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 110439353) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-(2-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-(2-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110439353 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-(2-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccccc3Cl)CC2)cc1Cl |
| InChI | InChI=1S/C17H15Cl2NO/c1-11-6-7-12(10-15(11)19)20-16(21)17(8-9-17)13-4-2-3-5-14(13)18/h2-7,10H,8-9H2,1H3,(H,20,21) |
| InChIKey | GQFNWSIKUXCZHX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |