C21H24ClNO2 — CID 100676610
1-(2-chlorophenyl)-N-(4-methoxy-3-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 100676610) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(4-methoxy-3-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(4-methoxy-3-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100676610 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(4-methoxy-3-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccccc3Cl)CCCCC2)cc1C |
| InChI | InChI=1S/C21H24ClNO2/c1-15-14-16(10-11-19(15)25-2)23-20(24)21(12-6-3-7-13-21)17-8-4-5-9-18(17)22/h4-5,8-11,14H,3,6-7,12-13H2,1-2H3,(H,23,24) |
| InChIKey | DXRBKHUXQBNAJR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |