C24H27ClN2O2 — CID 100747004
1-(2-chlorophenyl)-N-[3-cyano-4-(2-methylpropoxy)phenyl]cyclohexane-1-carboxamide (PubChem CID 100747004) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[3-cyano-4-(2-methylpropoxy)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[3-cyano-4-(2-methylpropoxy)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100747004 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[3-cyano-4-(2-methylpropoxy)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)COc1ccc(NC(=O)C2(c3ccccc3Cl)CCCCC2)cc1C#N |
| InChI | InChI=1S/C24H27ClN2O2/c1-17(2)16-29-22-11-10-19(14-18(22)15-26)27-23(28)24(12-6-3-7-13-24)20-8-4-5-9-21(20)25/h4-5,8-11,14,17H,3,6-7,12-13,16H2,1-2H3,(H,27,28) |
| InChIKey | JZPWRKYSHNYUHF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |