C23H25FN2O2 — CID 100720957
N-(4-butoxy-3-cyanophenyl)-1-(2-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 100720957) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is N-(4-butoxy-3-cyanophenyl)-1-(2-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-(4-butoxy-3-cyanophenyl)-1-(2-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100720957 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-(4-butoxy-3-cyanophenyl)-1-(2-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2(c3ccccc3F)CCCC2)cc1C#N |
| InChI | InChI=1S/C23H25FN2O2/c1-2-3-14-28-21-11-10-18(15-17(21)16-25)26-22(27)23(12-6-7-13-23)19-8-4-5-9-20(19)24/h4-5,8-11,15H,2-3,6-7,12-14H2,1H3,(H,26,27) |
| InChIKey | IDSNGXHKYGGSNQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|