C24H27FN2O2 — CID 100746032
N-[4-[(2R)-butan-2-yl]oxy-2-cyanophenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 100746032) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]oxy-2-cyanophenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]oxy-2-cyanophenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100746032 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]oxy-2-cyanophenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C2(c3ccccc3F)CCCCC2)c(C#N)c1 |
| InChI | InChI=1S/C24H27FN2O2/c1-3-17(2)29-19-11-12-22(18(15-19)16-26)27-23(28)24(13-7-4-8-14-24)20-9-5-6-10-21(20)25/h5-6,9-12,15,17H,3-4,7-8,13-14H2,1-2H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | BXFSFNGYKUAZHG-QGZVFWFLSA-N |
| XLogP | 5.72 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |