C25H30N2O2 — CID 100745430
N-[4-[(2S)-butan-2-yl]oxy-2-cyanophenyl]-1-(3-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 100745430) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]oxy-2-cyanophenyl]-1-(3-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]oxy-2-cyanophenyl]-1-(3-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100745430 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]oxy-2-cyanophenyl]-1-(3-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | CC[C@H](C)Oc1ccc(NC(=O)C2(c3cccc(C)c3)CCCCC2)c(C#N)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-4-19(3)29-22-11-12-23(20(16-22)17-26)27-24(28)25(13-6-5-7-14-25)21-10-8-9-18(2)15-21/h8-12,15-16,19H,4-7,13-14H2,1-3H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | XQALXVLHLLWJRE-IBGZPJMESA-N |
| XLogP | 5.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |