C22H23F4NO2 — CID 100745829
N-[4-ethoxy-3-(trifluoromethyl)phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 100745829) has the molecular formula C22H23F4NO2 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-[4-ethoxy-3-(trifluoromethyl)phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-ethoxy-3-(trifluoromethyl)phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100745829 |
| Molecular Formula | C22H23F4NO2 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[4-ethoxy-3-(trifluoromethyl)phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(c3ccccc3F)CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H23F4NO2/c1-2-29-19-11-10-15(14-17(19)22(24,25)26)27-20(28)21(12-6-3-7-13-21)16-8-4-5-9-18(16)23/h4-5,8-11,14H,2-3,6-7,12-13H2,1H3,(H,27,28) |
| InChIKey | JZZJOXNNCZHAPE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |