C26H35FN2O2 — CID 100673292
N-[4-[3-(diethylamino)propoxy]phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 100673292) has the molecular formula C26H35FN2O2 and a molecular weight of 426.58 g/mol. Its IUPAC name is N-[4-[3-(diethylamino)propoxy]phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[3-(diethylamino)propoxy]phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100673292 |
| Molecular Formula | C26H35FN2O2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-[4-[3-(diethylamino)propoxy]phenyl]-1-(2-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | CCN(CC)CCCOc1ccc(NC(=O)C2(c3ccccc3F)CCCCC2)cc1 |
| InChI | InChI=1S/C26H35FN2O2/c1-3-29(4-2)19-10-20-31-22-15-13-21(14-16-22)28-25(30)26(17-8-5-9-18-26)23-11-6-7-12-24(23)27/h6-7,11-16H,3-5,8-10,17-20H2,1-2H3,(H,28,30) |
| InChIKey | RYBXORSYDVINJJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|